2,3-Dimethyl-1,3-butadiene

Top Quality Chinese Factory supply 513-81-5 2,3-Dimethyl-1,3-butadiene We provide high quality 2,3-Dimethyl-1,3-butadiene (CAS 513-81-5), at a very affordable prices to our customers.

1.What is the 2,3-Dimethyl-1,3-butadiene ?

2,3-Dimethyl-1,3-butadiene, a hydrocarbon diene, is a chemical compound with the molecular formula C6H10. It features two double bonds, which make it a reactive intermediate in various chemical reactions. This colorless to light yellow liquid has a strong characteristic odor and requires careful handling due to its potential to cause skin and eye irritation or respiratory issues. Moreover, it presents fire and explosion hazards, necessitating proper safety measures during its use.

Used in Chemical Production Industry:
2,3-Dimethyl-1,3-butadiene is used as a reactive intermediate for the industrial production of various chemical products. Its presence of two double bonds allows it to participate in a wide range of chemical reactions, making it a valuable component in the synthesis of different compounds.
Used in Polymer Synthesis:
In the polymer industry, 2,3-Dimethyl-1,3-butadiene is utilized as a monomer in the production of polymers. Its reactive double bonds enable it to undergo polymerization reactions, leading to the formation of polymers with specific properties and applications.
Used in Pharmaceutical Industry:
2,3-Dimethyl-1,3-butadiene is employed as a starting material or intermediate in the synthesis of certain pharmaceutical compounds. Its reactivity allows for the creation of various drug molecules with potential therapeutic effects.
Used in Flavor and Fragrance Industry:
Due to its strong characteristic odor, 2,3-Dimethyl-1,3-butadiene is used as a component in the development of flavors and fragrances. Its unique scent can be incorporated into various products to create distinct and appealing aromas.
Used in Dye and Pigment Industry:
2,3-Dimethyl-1,3-butadiene is utilized in the production of dyes and pigments due to its ability to undergo chemical reactions that result in the formation of colored compounds. These dyes and pigments can be used in various applications, such as textiles, plastics, and paints.

2.What is the CAS number for 2,3-Dimethyl-1,3-butadiene ?

The CAS number of 2,3-Dimethyl-1,3-butadiene is 513-81-5.

More information of 2,3-Dimethyl-1,3-butadiene 513-81-5 are:

3.What is the molecular formula of 2,3-Dimethyl-1,3-butadiene ?

The chemical formula of?2,3-Dimethyl-1,3-butadiene is C6H10 which containing 6 Carbon atoms and 10 Hydrogen atoms,and the molecular weight, and the molecular weight of 2,3-Dimethyl-1,3-butadiene is 82.1454

4.What is 2,3-Dimethyl-1,3-butadiene(513-81-5)used for?

2,3-Dimethyl-1,3-butadiene, a hydrocarbon diene, is a chemical compound with the molecular formula C6H10. It features two double bonds, which make it a reactive intermediate in various chemical reactions. This colorless to light yellow liquid has a strong characteristic odor and requires careful handling due to its potential to cause skin and eye irritation or respiratory issues. Moreover, it presents fire and explosion hazards, necessitating proper safety measures during its use.

InChI:InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3

Relevant articles related to 2,3-Dimethyl-1,3-butadiene:

5.Top Quality Chinese Factory supply 513-81-5 2,3-Dimethyl-1,3-butadiene

Hangzhou Wanghai Inport And Export Co.,Ltd is a quality supplier of 2,3-Dimethyl-1,3-butadiene. Our main goal is customer satisfaction. Contact us to negotiate the best price for your business on 2,3-Dimethyl-1,3-butadiene 513-81-5.